* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4,4-DIFLUORO-1-PHENYLBUTAN-2-AMINE |
English Synonyms: | 4,4-DIFLUORO-1-PHENYLBUTAN-2-AMINE |
MDL Number.: | MFCD16858358 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)CC(CC(F)F)N |
InChi: | InChI=1S/C10H13F2N/c11-10(12)7-9(13)6-8-4-2-1-3-5-8/h1-5,9-10H,6-7,13H2 |
InChiKey: | InChIKey=JJSDMMPFMJNYPT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.