* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ETHYL((2-[1-METHYL-3-(THIOPHEN-2-YL)-1H-1,2,4-TRIAZOL-5-YL]ETHYL))AMINE |
English Synonyms: | ETHYL((2-[1-METHYL-3-(THIOPHEN-2-YL)-1H-1,2,4-TRIAZOL-5-YL]ETHYL))AMINE |
MDL Number.: | MFCD16859185 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCNCCc1nc(nn1C)c2cccs2 |
InChi: | InChI=1S/C11H16N4S/c1-3-12-7-6-10-13-11(14-15(10)2)9-5-4-8-16-9/h4-5,8,12H,3,6-7H2,1-2H3 |
InChiKey: | InChIKey=JVFSBPFDMKZUMC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.