* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-(FURAN-3-YL)-3-(THIOPHEN-2-YL)-1H-1,2,4-TRIAZOLE |
English Synonyms: | 5-(FURAN-3-YL)-3-(THIOPHEN-2-YL)-1H-1,2,4-TRIAZOLE |
MDL Number.: | MFCD16859234 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cc(sc1)c2nc([nH]n2)c3ccoc3 |
InChi: | InChI=1S/C10H7N3OS/c1-2-8(15-5-1)10-11-9(12-13-10)7-3-4-14-6-7/h1-6H,(H,11,12,13) |
InChiKey: | InChIKey=IUQDRAIFYCFFBG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.