* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-(2-METHOXYETHYL)-3-(THIOPHEN-2-YL)-1H-1,2,4-TRIAZOLE |
English Synonyms: | 5-(2-METHOXYETHYL)-3-(THIOPHEN-2-YL)-1H-1,2,4-TRIAZOLE |
MDL Number.: | MFCD16859251 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | COCCc1[nH]nc(n1)c2cccs2 |
InChi: | InChI=1S/C9H11N3OS/c1-13-5-4-8-10-9(12-11-8)7-3-2-6-14-7/h2-3,6H,4-5H2,1H3,(H,10,11,12) |
InChiKey: | InChIKey=DFFJTNBCUBXYNH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.