* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-(2-ETHOXYETHYL)-3-(THIOPHEN-2-YL)-1H-1,2,4-TRIAZOLE |
English Synonyms: | 5-(2-ETHOXYETHYL)-3-(THIOPHEN-2-YL)-1H-1,2,4-TRIAZOLE |
MDL Number.: | MFCD16859253 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCOCCc1[nH]nc(n1)c2cccs2 |
InChi: | InChI=1S/C10H13N3OS/c1-2-14-6-5-9-11-10(13-12-9)8-4-3-7-15-8/h3-4,7H,2,5-6H2,1H3,(H,11,12,13) |
InChiKey: | InChIKey=DPQCLQKMIUQUQC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.