* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | METHYL(([5-(THIOPHEN-2-YL)-1H-1,2,4-TRIAZOL-3-YL]METHYL))AMINE |
| English Synonyms: | METHYL(([5-(THIOPHEN-2-YL)-1H-1,2,4-TRIAZOL-3-YL]METHYL))AMINE |
| MDL Number.: | MFCD16859281 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CNCc1nc([nH]n1)c2cccs2 |
| InChi: | InChI=1S/C8H10N4S/c1-9-5-7-10-8(12-11-7)6-3-2-4-13-6/h2-4,9H,5H2,1H3,(H,10,11,12) |
| InChiKey: | InChIKey=QPLBAPWDWYHZSQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.