* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-6098213 |
English Synonyms: | ABAMACHEM ABA-6098213 |
MDL Number.: | MFCD16859862 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCC(CC#N)NS(=O)(=O)c1c(ccs1)Br |
InChi: | InChI=1S/C9H11BrN2O2S2/c1-2-7(3-5-11)12-16(13,14)9-8(10)4-6-15-9/h4,6-7,12H,2-3H2,1H3 |
InChiKey: | InChIKey=ZUZGFGVIFYAWSO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.