* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-6294760 |
English Synonyms: | ABAMACHEM ABA-6294760 |
MDL Number.: | MFCD16859890 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | c1cnc(c(n1)C#N)NC2CCS(=O)(=O)C2 |
InChi: | InChI=1S/C9H10N4O2S/c10-5-8-9(12-3-2-11-8)13-7-1-4-16(14,15)6-7/h2-3,7H,1,4,6H2,(H,12,13) |
InChiKey: | InChIKey=MWAKHKKKJKQZNM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.