* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-[1-(2-METHYLPROPYL)-1H-PYRAZOL-4-YL]PROPAN-1-ONE |
| English Synonyms: | 1-[1-(2-METHYLPROPYL)-1H-PYRAZOL-4-YL]PROPAN-1-ONE |
| MDL Number.: | MFCD16861603 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CCC(=O)c1cnn(c1)CC(C)C |
| InChi: | InChI=1S/C10H16N2O/c1-4-10(13)9-5-11-12(7-9)6-8(2)3/h5,7-8H,4,6H2,1-3H3 |
| InChiKey: | InChIKey=MGVKGUAJPXNCRQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.