* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-[1-(3,3-DIMETHYLBUTYL)-1H-PYRAZOL-4-YL]PROPAN-1-OL |
| English Synonyms: | 1-[1-(3,3-DIMETHYLBUTYL)-1H-PYRAZOL-4-YL]PROPAN-1-OL |
| MDL Number.: | MFCD16862309 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCC(c1cnn(c1)CCC(C)(C)C)O |
| InChi: | InChI=1S/C12H22N2O/c1-5-11(15)10-8-13-14(9-10)7-6-12(2,3)4/h8-9,11,15H,5-7H2,1-4H3 |
| InChiKey: | InChIKey=PJXPABKWNQPSJZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.