* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-(1-CHLOROETHYL)-1-ETHYL-3,5-DIMETHYL-1H-PYRAZOLE |
| English Synonyms: | 4-(1-CHLOROETHYL)-1-ETHYL-3,5-DIMETHYL-1H-PYRAZOLE |
| MDL Number.: | MFCD16862324 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CCn1c(c(c(n1)C)C(C)Cl)C |
| InChi: | InChI=1S/C9H15ClN2/c1-5-12-8(4)9(6(2)10)7(3)11-12/h6H,5H2,1-4H3 |
| InChiKey: | InChIKey=KIMQDFWHLSBYKY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.