* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-(1-CHLOROETHYL)-1-(2,2-DIFLUOROETHYL)-1H-PYRAZOLE |
| English Synonyms: | 4-(1-CHLOROETHYL)-1-(2,2-DIFLUOROETHYL)-1H-PYRAZOLE |
| MDL Number.: | MFCD16862428 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CC(c1cnn(c1)CC(F)F)Cl |
| InChi: | InChI=1S/C7H9ClF2N2/c1-5(8)6-2-11-12(3-6)4-7(9)10/h2-3,5,7H,4H2,1H3 |
| InChiKey: | InChIKey=OENOYJDEEVXBNI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.