* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-(2-METHYLPROPYL)-1,2,3,4-TETRAHYDRONAPHTHALEN-1-OL |
| English Synonyms: | 7-(2-METHYLPROPYL)-1,2,3,4-TETRAHYDRONAPHTHALEN-1-OL |
| MDL Number.: | MFCD16862953 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | CC(C)Cc1ccc2c(c1)C(CCC2)O |
| InChi: | InChI=1S/C14H20O/c1-10(2)8-11-6-7-12-4-3-5-14(15)13(12)9-11/h6-7,9-10,14-15H,3-5,8H2,1-2H3 |
| InChiKey: | InChIKey=PIKKJUDFJGMWCD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.