* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-BUTYL-1,2,3,4-TETRAHYDRONAPHTHALEN-1-OL |
English Synonyms: | 7-BUTYL-1,2,3,4-TETRAHYDRONAPHTHALEN-1-OL |
MDL Number.: | MFCD16862956 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CCCCc1ccc2c(c1)C(CCC2)O |
InChi: | InChI=1S/C14H20O/c1-2-3-5-11-8-9-12-6-4-7-14(15)13(12)10-11/h8-10,14-15H,2-7H2,1H3 |
InChiKey: | InChIKey=WIYJACQAXLKEJQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.