* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6,8-DIMETHYL-1,2,4,5-TETRAHYDRO-3-BENZOXEPIN-1-OL |
| English Synonyms: | 6,8-DIMETHYL-1,2,4,5-TETRAHYDRO-3-BENZOXEPIN-1-OL |
| MDL Number.: | MFCD16862958 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | Cc1cc(c2c(c1)C(COCC2)O)C |
| InChi: | InChI=1S/C12H16O2/c1-8-5-9(2)10-3-4-14-7-12(13)11(10)6-8/h5-6,12-13H,3-4,7H2,1-2H3 |
| InChiKey: | InChIKey=PUPCCGBYDXTJFD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.