* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6,9-DIMETHYL-1,2,4,5-TETRAHYDRO-3-BENZOXEPIN-1-OL |
| English Synonyms: | 6,9-DIMETHYL-1,2,4,5-TETRAHYDRO-3-BENZOXEPIN-1-OL |
| MDL Number.: | MFCD16862959 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | Cc1ccc(c2c1CCOCC2O)C |
| InChi: | InChI=1S/C12H16O2/c1-8-3-4-9(2)12-10(8)5-6-14-7-11(12)13/h3-4,11,13H,5-7H2,1-2H3 |
| InChiKey: | InChIKey=JIFJBWUYJKFHHL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.