* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-METHYL-1,2,4,5-TETRAHYDRO-3-BENZOXEPIN-1-OL |
| English Synonyms: | 8-METHYL-1,2,4,5-TETRAHYDRO-3-BENZOXEPIN-1-OL |
| MDL Number.: | MFCD16862960 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | Cc1ccc2c(c1)C(COCC2)O |
| InChi: | InChI=1S/C11H14O2/c1-8-2-3-9-4-5-13-7-11(12)10(9)6-8/h2-3,6,11-12H,4-5,7H2,1H3 |
| InChiKey: | InChIKey=QBQDTSWJZXENRE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.