* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-BROMO-1-METHOXY-6,7,8,9-TETRAHYDRO-5H-BENZO[7]ANNULEN-5-OL |
English Synonyms: | 4-BROMO-1-METHOXY-6,7,8,9-TETRAHYDRO-5H-BENZO[7]ANNULEN-5-OL |
MDL Number.: | MFCD16862963 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | COc1ccc(c2c1CCCCC2O)Br |
InChi: | InChI=1S/C12H15BrO2/c1-15-11-7-6-9(13)12-8(11)4-2-3-5-10(12)14/h6-7,10,14H,2-5H2,1H3 |
InChiKey: | InChIKey=HZXDDOMJZVXHJE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.