* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-BROMO-6-ETHOXY-1,2,4,5-TETRAHYDRO-3-BENZOXEPIN-1-OL |
English Synonyms: | 9-BROMO-6-ETHOXY-1,2,4,5-TETRAHYDRO-3-BENZOXEPIN-1-OL |
MDL Number.: | MFCD16862968 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCOc1ccc(c2c1CCOCC2O)Br |
InChi: | InChI=1S/C12H15BrO3/c1-2-16-11-4-3-9(13)12-8(11)5-6-15-7-10(12)14/h3-4,10,14H,2,5-7H2,1H3 |
InChiKey: | InChIKey=NWJYLVSDIKACDG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.