* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-ETHOXY-4-METHYL-6,7,8,9-TETRAHYDRO-5H-BENZO[7]ANNULEN-5-OL |
| English Synonyms: | 1-ETHOXY-4-METHYL-6,7,8,9-TETRAHYDRO-5H-BENZO[7]ANNULEN-5-OL |
| MDL Number.: | MFCD16862970 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCOc1ccc(c2c1CCCCC2O)C |
| InChi: | InChI=1S/C14H20O2/c1-3-16-13-9-8-10(2)14-11(13)6-4-5-7-12(14)15/h8-9,12,15H,3-7H2,1-2H3 |
| InChiKey: | InChIKey=KWWWPDRSMSTMSP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.