* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-ETHOXY-9-METHYL-1,2,4,5-TETRAHYDRO-3-BENZOXEPIN-1-OL |
English Synonyms: | 6-ETHOXY-9-METHYL-1,2,4,5-TETRAHYDRO-3-BENZOXEPIN-1-OL |
MDL Number.: | MFCD16862972 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCOc1ccc(c2c1CCOCC2O)C |
InChi: | InChI=1S/C13H18O3/c1-3-16-12-5-4-9(2)13-10(12)6-7-15-8-11(13)14/h4-5,11,14H,3,6-8H2,1-2H3 |
InChiKey: | InChIKey=GHHARFBJCRXNHW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.