* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-METHOXY-1,2,4,5-TETRAHYDRO-3-BENZOXEPIN-1-OL |
English Synonyms: | 8-METHOXY-1,2,4,5-TETRAHYDRO-3-BENZOXEPIN-1-OL |
MDL Number.: | MFCD16862973 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | COc1ccc2c(c1)C(COCC2)O |
InChi: | InChI=1S/C11H14O3/c1-13-9-3-2-8-4-5-14-7-11(12)10(8)6-9/h2-3,6,11-12H,4-5,7H2,1H3 |
InChiKey: | InChIKey=IVIBNQBZEOWCQY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.