* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-CHLORO-8-METHOXY-1,2,4,5-TETRAHYDRO-3-BENZOXEPIN-1-OL |
| English Synonyms: | 6-CHLORO-8-METHOXY-1,2,4,5-TETRAHYDRO-3-BENZOXEPIN-1-OL |
| MDL Number.: | MFCD16862984 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | COc1cc2c(c(c1)Cl)CCOCC2O |
| InChi: | InChI=1S/C11H13ClO3/c1-14-7-4-9-8(10(12)5-7)2-3-15-6-11(9)13/h4-5,11,13H,2-3,6H2,1H3 |
| InChiKey: | InChIKey=NTSZPPLOQWLSRP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.