* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7,8-DIMETHOXY-1,2,4,5-TETRAHYDRO-3-BENZOXEPIN-1-OL |
| English Synonyms: | 7,8-DIMETHOXY-1,2,4,5-TETRAHYDRO-3-BENZOXEPIN-1-OL |
| MDL Number.: | MFCD16862985 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | COc1cc2c(cc1OC)C(COCC2)O |
| InChi: | InChI=1S/C12H16O4/c1-14-11-5-8-3-4-16-7-10(13)9(8)6-12(11)15-2/h5-6,10,13H,3-4,7H2,1-2H3 |
| InChiKey: | InChIKey=COZDWNPWJUVRPV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.