* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6,9-DIMETHOXY-1,2,4,5-TETRAHYDRO-3-BENZOXEPIN-1-OL |
| English Synonyms: | 6,9-DIMETHOXY-1,2,4,5-TETRAHYDRO-3-BENZOXEPIN-1-OL |
| MDL Number.: | MFCD16862989 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | COc1ccc(c2c1CCOCC2O)OC |
| InChi: | InChI=1S/C12H16O4/c1-14-10-3-4-11(15-2)12-8(10)5-6-16-7-9(12)13/h3-4,9,13H,5-7H2,1-2H3 |
| InChiKey: | InChIKey=JLYHZNVIWZJSQM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.