* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1,2,4,5-TETRAHYDRO-3-BENZOXEPIN-1-OL |
| English Synonyms: | 1,2,4,5-TETRAHYDRO-3-BENZOXEPIN-1-OL |
| MDL Number.: | MFCD16862994 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1ccc2c(c1)CCOCC2O |
| InChi: | InChI=1S/C10H12O2/c11-10-7-12-6-5-8-3-1-2-4-9(8)10/h1-4,10-11H,5-7H2 |
| InChiKey: | InChIKey=KZJXFTSBSBPXNO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.