* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-CHLORO-1,2,4,5-TETRAHYDRO-3-BENZOXEPIN-1-OL |
| English Synonyms: | 8-CHLORO-1,2,4,5-TETRAHYDRO-3-BENZOXEPIN-1-OL |
| MDL Number.: | MFCD16862995 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1cc2c(cc1Cl)C(COCC2)O |
| InChi: | InChI=1S/C10H11ClO2/c11-8-2-1-7-3-4-13-6-10(12)9(7)5-8/h1-2,5,10,12H,3-4,6H2 |
| InChiKey: | InChIKey=VAWBPBPIVMLHRB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.