* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6,8-DIFLUORO-1,2,4,5-TETRAHYDRO-3-BENZOXEPIN-1-OL |
| English Synonyms: | 6,8-DIFLUORO-1,2,4,5-TETRAHYDRO-3-BENZOXEPIN-1-OL |
| MDL Number.: | MFCD16863003 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1c(cc(c2c1C(COCC2)O)F)F |
| InChi: | InChI=1S/C10H10F2O2/c11-6-3-8-7(9(12)4-6)1-2-14-5-10(8)13/h3-4,10,13H,1-2,5H2 |
| InChiKey: | InChIKey=BMCVTPUXQYKRLO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.