* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6,9-DICHLORO-1,2,4,5-TETRAHYDRO-3-BENZOXEPIN-1-OL |
| English Synonyms: | 6,9-DICHLORO-1,2,4,5-TETRAHYDRO-3-BENZOXEPIN-1-OL |
| MDL Number.: | MFCD16863009 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1cc(c2c(c1Cl)CCOCC2O)Cl |
| InChi: | InChI=1S/C10H10Cl2O2/c11-7-1-2-8(12)10-6(7)3-4-14-5-9(10)13/h1-2,9,13H,3-5H2 |
| InChiKey: | InChIKey=VCVFGDAQXCHUDK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.