* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6,9-DIFLUORO-1,2,4,5-TETRAHYDRO-3-BENZOXEPIN-1-OL |
English Synonyms: | 6,9-DIFLUORO-1,2,4,5-TETRAHYDRO-3-BENZOXEPIN-1-OL |
MDL Number.: | MFCD16863012 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1cc(c2c(c1F)CCOCC2O)F |
InChi: | InChI=1S/C10H10F2O2/c11-7-1-2-8(12)10-6(7)3-4-14-5-9(10)13/h1-2,9,13H,3-5H2 |
InChiKey: | InChIKey=KCOIHCTXTIIZGM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.