* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-(BUTAN-2-YL)-1,2,4,5-TETRAHYDRO-3-BENZOXEPIN-1-OL |
English Synonyms: | 8-(BUTAN-2-YL)-1,2,4,5-TETRAHYDRO-3-BENZOXEPIN-1-OL |
MDL Number.: | MFCD16863015 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCC(C)c1ccc2c(c1)C(COCC2)O |
InChi: | InChI=1S/C14H20O2/c1-3-10(2)12-5-4-11-6-7-16-9-14(15)13(11)8-12/h4-5,8,10,14-15H,3,6-7,9H2,1-2H3 |
InChiKey: | InChIKey=QSLJNVALDAQQQV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.