* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-PROPYL-1,2,3,4-TETRAHYDRONAPHTHALEN-1-OL |
| English Synonyms: | 7-PROPYL-1,2,3,4-TETRAHYDRONAPHTHALEN-1-OL |
| MDL Number.: | MFCD16863020 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | CCCc1ccc2c(c1)C(CCC2)O |
| InChi: | InChI=1S/C13H18O/c1-2-4-10-7-8-11-5-3-6-13(14)12(11)9-10/h7-9,13-14H,2-6H2,1H3 |
| InChiKey: | InChIKey=UTGUATBTZYPATO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.