* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-BUTYL-1-CHLORO-1,2,4,5-TETRAHYDRO-3-BENZOXEPINE |
| English Synonyms: | 8-BUTYL-1-CHLORO-1,2,4,5-TETRAHYDRO-3-BENZOXEPINE |
| MDL Number.: | MFCD16863024 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | CCCCc1ccc2c(c1)C(COCC2)Cl |
| InChi: | InChI=1S/C14H19ClO/c1-2-3-4-11-5-6-12-7-8-16-10-14(15)13(12)9-11/h5-6,9,14H,2-4,7-8,10H2,1H3 |
| InChiKey: | InChIKey=QUVSDCIVKPINBF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.