* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6,10-DICHLORO-2H,3H,7H,8H,9H,10H-NAPHTHO[1,2-B][1,4]DIOXINE |
| English Synonyms: | 6,10-DICHLORO-2H,3H,7H,8H,9H,10H-NAPHTHO[1,2-B][1,4]DIOXINE |
| MDL Number.: | MFCD16863035 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | c1c2c(c3c(c1Cl)CCCC3Cl)OCCO2 |
| InChi: | InChI=1S/C12H12Cl2O2/c13-8-3-1-2-7-9(14)6-10-12(11(7)8)16-5-4-15-10/h6,8H,1-5H2 |
| InChiKey: | InChIKey=WGEIMZHLDKQXAF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.