* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9-CHLORO-2-ETHOXY-6,7,8,9-TETRAHYDRO-5H-BENZO[7]ANNULENE |
| English Synonyms: | 9-CHLORO-2-ETHOXY-6,7,8,9-TETRAHYDRO-5H-BENZO[7]ANNULENE |
| MDL Number.: | MFCD16863052 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | CCOc1ccc2c(c1)C(CCCC2)Cl |
| InChi: | InChI=1S/C13H17ClO/c1-2-15-11-8-7-10-5-3-4-6-13(14)12(10)9-11/h7-9,13H,2-6H2,1H3 |
| InChiKey: | InChIKey=VETUXFIWJYBOML-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.