* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-BROMO-2H,3H,4H,7H,8H,9H,10H-NAPHTHO[2,3-B][1,4]DIOXEPINE |
| English Synonyms: | 7-BROMO-2H,3H,4H,7H,8H,9H,10H-NAPHTHO[2,3-B][1,4]DIOXEPINE |
| MDL Number.: | MFCD16863095 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | c1c2c(cc3c1OCCCO3)C(CCC2)Br |
| InChi: | InChI=1S/C13H15BrO2/c14-11-4-1-3-9-7-12-13(8-10(9)11)16-6-2-5-15-12/h7-8,11H,1-6H2 |
| InChiKey: | InChIKey=SPAKJEDQWUKKOK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.