* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9-BROMO-2-FLUORO-6,7,8,9-TETRAHYDRO-5H-BENZO[7]ANNULENE |
| English Synonyms: | 9-BROMO-2-FLUORO-6,7,8,9-TETRAHYDRO-5H-BENZO[7]ANNULENE |
| MDL Number.: | MFCD16863103 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | c1cc2c(cc1F)C(CCCC2)Br |
| InChi: | InChI=1S/C11H12BrF/c12-11-4-2-1-3-8-5-6-9(13)7-10(8)11/h5-7,11H,1-4H2 |
| InChiKey: | InChIKey=WOEIKCHBUUAQRD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.