* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ETHYL[(1-PENTYL-1H-1,2,3,4-TETRAZOL-5-YL)METHYL]AMINE |
English Synonyms: | ETHYL[(1-PENTYL-1H-1,2,3,4-TETRAZOL-5-YL)METHYL]AMINE |
MDL Number.: | MFCD16863592 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCCCCn1c(nnn1)CNCC |
InChi: | InChI=1S/C9H19N5/c1-3-5-6-7-14-9(8-10-4-2)11-12-13-14/h10H,3-8H2,1-2H3 |
InChiKey: | InChIKey=STTCHJFRZACLCF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.