* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | METHYL(([1-(PENTAN-3-YL)-1H-1,2,3,4-TETRAZOL-5-YL]METHYL))AMINE |
| English Synonyms: | METHYL(([1-(PENTAN-3-YL)-1H-1,2,3,4-TETRAZOL-5-YL]METHYL))AMINE |
| MDL Number.: | MFCD16863690 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CCC(CC)n1c(nnn1)CNC |
| InChi: | InChI=1S/C8H17N5/c1-4-7(5-2)13-8(6-9-3)10-11-12-13/h7,9H,4-6H2,1-3H3 |
| InChiKey: | InChIKey=JRZSDVAWSNBZRS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.