* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH774314 |
English Synonyms: | FCHGROUP FCH774314 |
MDL Number.: | MFCD16865297 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCOC(=O)CNC(=O)C1CCCOC1 |
InChi: | InChI=1S/C10H17NO4/c1-2-15-9(12)6-11-10(13)8-4-3-5-14-7-8/h8H,2-7H2,1H3,(H,11,13) |
InChiKey: | InChIKey=ORAYGFOEDCLMGC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.