* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC675998 |
| English Synonyms: | BCH-RESEARCH BC675998 |
| MDL Number.: | MFCD16865304 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CCOC(=O)CCNC(=O)C1CCCOC1 |
| InChi: | InChI=1S/C11H19NO4/c1-2-16-10(13)5-6-12-11(14)9-4-3-7-15-8-9/h9H,2-8H2,1H3,(H,12,14) |
| InChiKey: | InChIKey=WMMHEDXUXYRNIY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.