* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-(PROPAN-2-YL)-N-(1,3-THIAZOL-5-YLMETHYL)ANILINE |
English Synonyms: | 4-(PROPAN-2-YL)-N-(1,3-THIAZOL-5-YLMETHYL)ANILINE |
MDL Number.: | MFCD16865366 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CC(C)c1ccc(cc1)NCc2cncs2 |
InChi: | InChI=1S/C13H16N2S/c1-10(2)11-3-5-12(6-4-11)15-8-13-7-14-9-16-13/h3-7,9-10,15H,8H2,1-2H3 |
InChiKey: | InChIKey=WBAHTJALODHDPQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.