* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-METHYL-2-[(1,3-THIAZOL-5-YLMETHYL)AMINO]PENTAN-1-OL |
| English Synonyms: | 4-METHYL-2-[(1,3-THIAZOL-5-YLMETHYL)AMINO]PENTAN-1-OL |
| MDL Number.: | MFCD16865699 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | CC(C)CC(CO)NCc1cncs1 |
| InChi: | InChI=1S/C10H18N2OS/c1-8(2)3-9(6-13)12-5-10-4-11-7-14-10/h4,7-9,12-13H,3,5-6H2,1-2H3 |
| InChiKey: | InChIKey=LSJBADKATIADFH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.