* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (HEXAN-2-YL)(1,3-THIAZOL-5-YLMETHYL)AMINE |
English Synonyms: | (HEXAN-2-YL)(1,3-THIAZOL-5-YLMETHYL)AMINE |
MDL Number.: | MFCD16865775 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCCCC(C)NCc1cncs1 |
InChi: | InChI=1S/C10H18N2S/c1-3-4-5-9(2)12-7-10-6-11-8-13-10/h6,8-9,12H,3-5,7H2,1-2H3 |
InChiKey: | InChIKey=GGYUJSSATWOLBV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.