* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BUTYL[(1-METHYL-1H-1,2,3-TRIAZOL-4-YL)METHYL]AMINE |
| English Synonyms: | BUTYL[(1-METHYL-1H-1,2,3-TRIAZOL-4-YL)METHYL]AMINE |
| MDL Number.: | MFCD16869296 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCCCNCc1cn(nn1)C |
| InChi: | InChI=1S/C8H16N4/c1-3-4-5-9-6-8-7-12(2)11-10-8/h7,9H,3-6H2,1-2H3 |
| InChiKey: | InChIKey=ZJLCCRDYCZZYCS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.