* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | HEXYL[(1-METHYL-1H-1,2,3-TRIAZOL-4-YL)METHYL]AMINE |
English Synonyms: | HEXYL[(1-METHYL-1H-1,2,3-TRIAZOL-4-YL)METHYL]AMINE |
MDL Number.: | MFCD16869374 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCCCCCNCc1cn(nn1)C |
InChi: | InChI=1S/C10H20N4/c1-3-4-5-6-7-11-8-10-9-14(2)13-12-10/h9,11H,3-8H2,1-2H3 |
InChiKey: | InChIKey=JTIWYJTZTPOUNX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.