* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | METHYL(([2-(1,4-THIAZEPAN-4-YL)-1,3-THIAZOL-5-YL]METHYL))AMINE |
| English Synonyms: | METHYL(([2-(1,4-THIAZEPAN-4-YL)-1,3-THIAZOL-5-YL]METHYL))AMINE |
| MDL Number.: | MFCD16870510 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CNCc1cnc(s1)N2CCCSCC2 |
| InChi: | InChI=1S/C10H17N3S2/c1-11-7-9-8-12-10(15-9)13-3-2-5-14-6-4-13/h8,11H,2-7H2,1H3 |
| InChiKey: | InChIKey=ZJVAJXCYZYAIBF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.