* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 6-METHYL-2,3,5,6,7,8-HEXAHYDROCINNOLIN-3-ONE |
English Synonyms: | 6-METHYL-2,3,5,6,7,8-HEXAHYDROCINNOLIN-3-ONE ; 6-METHYL-5,6,7,8-TETRAHYDRO-2H-CINNOLIN-3-ONE |
MDL Number.: | MFCD16871344 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC1CCc2c(cc(=O)[nH]n2)C1 |
InChi: | InChI=1S/C9H12N2O/c1-6-2-3-8-7(4-6)5-9(12)11-10-8/h5-6H,2-4H2,1H3,(H,11,12) |
InChiKey: | InChIKey=NMCBPNYPCRRSQT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.