* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-METHYL-2,3,5,6,7,8-HEXAHYDROCINNOLIN-3-ONE |
English Synonyms: | 8-METHYL-2,3,5,6,7,8-HEXAHYDROCINNOLIN-3-ONE |
MDL Number.: | MFCD16871358 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC1CCCc2c1n[nH]c(=O)c2 |
InChi: | InChI=1S/C9H12N2O/c1-6-3-2-4-7-5-8(12)10-11-9(6)7/h5-6H,2-4H2,1H3,(H,10,12) |
InChiKey: | InChIKey=UEFVEEZFMMMHQC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.