* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-TERT-BUTYL-2,3,5,6,7,8-HEXAHYDROCINNOLIN-3-ONE |
| English Synonyms: | 8-TERT-BUTYL-2,3,5,6,7,8-HEXAHYDROCINNOLIN-3-ONE |
| MDL Number.: | MFCD16871359 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)C1CCCc2c1n[nH]c(=O)c2 |
| InChi: | InChI=1S/C12H18N2O/c1-12(2,3)9-6-4-5-8-7-10(15)13-14-11(8)9/h7,9H,4-6H2,1-3H3,(H,13,15) |
| InChiKey: | InChIKey=WGQFWGNDQPBYBS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.